C13H19ClN2 — CID 124566891
(4S)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-4-amine (PubChem CID 124566891) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is (4S)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-4-amine.
| Compound Name | (4S)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 124566891 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (4S)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-4-amine |
| SMILES | CC1(C)CNCC[C@]1(N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN2/c1-12(2)9-16-8-7-13(12,15)10-3-5-11(14)6-4-10/h3-6,16H,7-9,15H2,1-2H3/t13-/m0/s1 |
| InChIKey | GERPGAMMZYVTMO-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |