C20H16F5N7S — CID 124567260
N-[(4R)-3,3-difluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 124567260) has the molecular formula C20H16F5N7S and a molecular weight of 481.45 g/mol. Its IUPAC name is N-[(4R)-3,3-difluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(4R)-3,3-difluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 124567260 |
| Molecular Formula | C20H16F5N7S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[(4R)-3,3-difluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CC[C@@H](Nc3nc4c(-c5ccc(F)c(F)c5F)cccn4n3)C(F)(F)C2)n1 |
| InChI | InChI=1S/C20H16F5N7S/c1-10-26-19(33-30-10)31-8-6-14(20(24,25)9-31)27-18-28-17-12(3-2-7-32(17)29-18)11-4-5-13(21)16(23)15(11)22/h2-5,7,14H,6,8-9H2,1H3,(H,27,29)/t14-/m1/s1 |
| InChIKey | PPNDAGQUPNDRML-CQSZACIVSA-N |
| XLogP | 4.30 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|