C13H14N4O — CID 124567807
(2S,6R)-10-phenyl-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 124567807) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is (2S,6R)-10-phenyl-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2S,6R)-10-phenyl-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 124567807 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2S,6R)-10-phenyl-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | c1ccc(-c2nnn3c2CO[C@@H]2CNC[C@@H]23)cc1 |
| InChI | InChI=1S/C13H14N4O/c1-2-4-9(5-3-1)13-11-8-18-12-7-14-6-10(12)17(11)16-15-13/h1-5,10,12,14H,6-8H2/t10-,12+/m0/s1 |
| InChIKey | OUFQFXKBPLEJOP-CMPLNLGQSA-N |
| XLogP | 0.99 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |