C18H28N4 — CID 124568387
1-[(1S)-cyclohex-3-en-1-yl]-N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]methanamine (PubChem CID 124568387) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-[(1S)-cyclohex-3-en-1-yl]-N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]methanamine.
| Compound Name | 1-[(1S)-cyclohex-3-en-1-yl]-N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]methanamine |
|---|---|
| PubChem CID | 124568387 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-[(1S)-cyclohex-3-en-1-yl]-N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]methanamine |
| SMILES | CN1CCN(c2ncccc2CNC[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C18H28N4/c1-21-10-12-22(13-11-21)18-17(8-5-9-20-18)15-19-14-16-6-3-2-4-7-16/h2-3,5,8-9,16,19H,4,6-7,10-15H2,1H3/t16-/m1/s1 |
| InChIKey | LIAQUIGIEUFYSJ-MRXNPFEDSA-N |
| XLogP | 2.28 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|