About (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide
(2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide (PubChem CID 124568629) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide.
Molecular Properties
| Compound Name | (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide |
| PubChem CID | 124568629 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide |
| SMILES | CCO[C@@H](C)C(=O)NCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C11H19N3O2/c1-5-16-9(4)11(15)12-6-10-7(2)13-14-8(10)3/h9H,5-6H2,1-4H3,(H,12,15)(H,13,14)/t9-/m0/s1 |
| InChIKey | KUPVJMFGGOEASU-VIFPVBQESA-N |
| XLogP | 1.07 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide?
The IUPAC name of (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide (CID 124568629) is (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide.
What is the SMILES notation for (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide?
The canonical SMILES for (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide is CCO[C@@H](C)C(=O)NCc1c(C)n[nH]c1C.
What is the InChIKey of (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide?
The InChIKey is KUPVJMFGGOEASU-VIFPVBQESA-N. The full InChI is InChI=1S/C11H19N3O2/c1-5-16-9(4)11(15)12-6-10-7(2)13-14-8(10)3/h9H,5-6H2,1-4H3,(H,12,15)(H,13,14)/t9-/m0/s1.
What are the key properties of (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide?
(2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide has a molecular weight of 225.29 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-ethoxypropanamide is sourced from PubChem (CID 124568629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).