C14H17BrN2O3 — CID 124568699
N-(5-bromo-2-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide (PubChem CID 124568699) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 124568699 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C14H17BrN2O3/c1-9-4-5-10(15)7-12(9)16-13(19)14(20)17-6-2-3-11(17)8-18/h4-5,7,11,18H,2-3,6,8H2,1H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | MFXGZOKCKXSPNP-NSHDSACASA-N |
| XLogP | 1.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|