C18H11ClN2O2S2 — CID 124571908
2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 124571908) has the molecular formula C18H11ClN2O2S2 and a molecular weight of 386.89 g/mol. Its IUPAC name is 2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 124571908 |
| Molecular Formula | C18H11ClN2O2S2 |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(/C=C2/SC(=S)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C18H11ClN2O2S2/c19-13-3-5-14(6-4-13)21-17(22)16(25-18(21)24)11-12-1-7-15(8-2-12)23-10-9-20/h1-8,11H,10H2/b16-11+ |
| InChIKey | MMOGVEVKVXMTMS-LFIBNONCSA-N |
| XLogP | 4.65 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|