C14H19N3O2 — CID 124572102
[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-amino-3-pyridinyl)methanone (PubChem CID 124572102) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-amino-3-pyridinyl)methanone.
| Compound Name | [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-amino-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 124572102 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-amino-3-pyridinyl)methanone |
| SMILES | Nc1ccncc1C(=O)N1CCO[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H19N3O2/c15-11-5-6-16-9-10(11)14(18)17-7-8-19-13-4-2-1-3-12(13)17/h5-6,9,12-13H,1-4,7-8H2,(H2,15,16)/t12-,13-/m1/s1 |
| InChIKey | SXXKBZWDRFXKDD-CHWSQXEVSA-N |
| XLogP | 1.45 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |