C17H26F2N2OS — CID 124572393
(1S)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]-N-(2-piperidin-1-ylethyl)ethanamine (PubChem CID 124572393) has the molecular formula C17H26F2N2OS and a molecular weight of 344.47 g/mol. Its IUPAC name is (1S)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]-N-(2-piperidin-1-ylethyl)ethanamine.
| Compound Name | (1S)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]-N-(2-piperidin-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 124572393 |
| Molecular Formula | C17H26F2N2OS |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1S)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]-N-(2-piperidin-1-ylethyl)ethanamine |
| SMILES | COc1cc([C@H](C)NCCN2CCCCC2)ccc1SC(F)F |
| InChI | InChI=1S/C17H26F2N2OS/c1-13(20-8-11-21-9-4-3-5-10-21)14-6-7-16(23-17(18)19)15(12-14)22-2/h6-7,12-13,17,20H,3-5,8-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | LFIHOMMHUZROBY-ZDUSSCGKSA-N |
| XLogP | 4.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |