C14H17N3O3S — CID 124572594
4-[[(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]benzonitrile (PubChem CID 124572594) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-[[(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]benzonitrile.
| Compound Name | 4-[[(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 124572594 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[[(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]benzonitrile |
| SMILES | CN1CCO[C@@H]2CN(S(=O)(=O)c3ccc(C#N)cc3)C[C@@H]21 |
| InChI | InChI=1S/C14H17N3O3S/c1-16-6-7-20-14-10-17(9-13(14)16)21(18,19)12-4-2-11(8-15)3-5-12/h2-5,13-14H,6-7,9-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | PQGBIUBGMJSQGV-UONOGXRCSA-N |
| XLogP | 0.26 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |