C18H22F2N4O3 — CID 124572612
N-[(1R,2R)-2-aminocyclohexyl]-3-[(4R)-1-(2,4-difluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 124572612) has the molecular formula C18H22F2N4O3 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-3-[(4R)-1-(2,4-difluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-3-[(4R)-1-(2,4-difluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 124572612 |
| Molecular Formula | C18H22F2N4O3 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-3-[(4R)-1-(2,4-difluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)CC[C@H]1NC(=O)N(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C18H22F2N4O3/c19-10-5-7-15(11(20)9-10)24-17(26)14(23-18(24)27)6-8-16(25)22-13-4-2-1-3-12(13)21/h5,7,9,12-14H,1-4,6,8,21H2,(H,22,25)(H,23,27)/t12-,13-,14-/m1/s1 |
| InChIKey | DGWPJTWWRDZZFX-MGPQQGTHSA-N |
| XLogP | 1.56 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|