C17H22N4O2 — CID 124572827
N-[[(3R)-1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]pyrazin-2-amine (PubChem CID 124572827) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[[(3R)-1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]pyrazin-2-amine.
| Compound Name | N-[[(3R)-1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 124572827 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[[(3R)-1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]pyrazin-2-amine |
| SMILES | COc1cc(OC)cc(N2CC[C@H](CNc3cnccn3)C2)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-22-15-7-14(8-16(9-15)23-2)21-6-3-13(12-21)10-20-17-11-18-4-5-19-17/h4-5,7-9,11,13H,3,6,10,12H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | MJDNRUOSPMVMNJ-CYBMUJFWSA-N |
| XLogP | 2.43 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |