C16H19F3N2O2 — CID 124573188
(4aS,8aS)-N-[2-(trifluoromethyl)phenyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carboxamide (PubChem CID 124573188) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is (4aS,8aS)-N-[2-(trifluoromethyl)phenyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carboxamide.
| Compound Name | (4aS,8aS)-N-[2-(trifluoromethyl)phenyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 124573188 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (4aS,8aS)-N-[2-(trifluoromethyl)phenyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N1CC[C@@H]2OCCC[C@H]2C1 |
| InChI | InChI=1S/C16H19F3N2O2/c17-16(18,19)12-5-1-2-6-13(12)20-15(22)21-8-7-14-11(10-21)4-3-9-23-14/h1-2,5-6,11,14H,3-4,7-10H2,(H,20,22)/t11-,14-/m0/s1 |
| InChIKey | OOLSGSPJJRFWDG-FZMZJTMJSA-N |
| XLogP | 3.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |