C15H17F4NO3 — CID 124574185
4-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 124574185) has the molecular formula C15H17F4NO3 and a molecular weight of 335.30 g/mol. Its IUPAC name is 4-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 124574185 |
| Molecular Formula | C15H17F4NO3 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](CO[C@@H]1CCOC1)NC(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H17F4NO3/c1-9(7-23-11-4-5-22-8-11)20-14(21)12-3-2-10(16)6-13(12)15(17,18)19/h2-3,6,9,11H,4-5,7-8H2,1H3,(H,20,21)/t9-,11+/m0/s1 |
| InChIKey | ODUSMZGFXMYCJF-GXSJLCMTSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |