C17H17FN2OS — CID 124574317
(5-fluoro-3-pyridinyl)-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 124574317) has the molecular formula C17H17FN2OS and a molecular weight of 316.40 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl)-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-fluoro-3-pyridinyl)-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 124574317 |
| Molecular Formula | C17H17FN2OS |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (5-fluoro-3-pyridinyl)-[(3R)-3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cncc(F)c1)N1CC[C@@H](CSc2ccccc2)C1 |
| InChI | InChI=1S/C17H17FN2OS/c18-15-8-14(9-19-10-15)17(21)20-7-6-13(11-20)12-22-16-4-2-1-3-5-16/h1-5,8-10,13H,6-7,11-12H2/t13-/m1/s1 |
| InChIKey | WRUGOMACCWQQQC-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |