C10H19NO2S — CID 124574860
(2S)-2-[(2R)-2-ethylthiomorpholin-4-yl]butanoic acid (PubChem CID 124574860) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-ethylthiomorpholin-4-yl]butanoic acid.
| Compound Name | (2S)-2-[(2R)-2-ethylthiomorpholin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 124574860 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2S)-2-[(2R)-2-ethylthiomorpholin-4-yl]butanoic acid |
| SMILES | CC[C@@H]1CN([C@@H](CC)C(=O)O)CCS1 |
| InChI | InChI=1S/C10H19NO2S/c1-3-8-7-11(5-6-14-8)9(4-2)10(12)13/h8-9H,3-7H2,1-2H3,(H,12,13)/t8-,9+/m1/s1 |
| InChIKey | KGVZXFTYNAAENY-BDAKNGLRSA-N |
| XLogP | 1.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |