C14H20N4O2S — CID 124575636
3-[2-[[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]ethyl]imidazolidine-2,4-dione (PubChem CID 124575636) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-[2-[[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124575636 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-[2-[[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]ethyl]imidazolidine-2,4-dione |
| SMILES | CCc1nc2c(s1)[C@@H](NCCN1C(=O)CNC1=O)CCC2 |
| InChI | InChI=1S/C14H20N4O2S/c1-2-11-17-10-5-3-4-9(13(10)21-11)15-6-7-18-12(19)8-16-14(18)20/h9,15H,2-8H2,1H3,(H,16,20)/t9-/m0/s1 |
| InChIKey | IVMXPMVPPGCTCR-VIFPVBQESA-N |
| XLogP | 1.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|