C15H19N3O5S2 — CID 124577686
(3aR,6aS)-5,5-dioxo-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 124577686) has the molecular formula C15H19N3O5S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (3aR,6aS)-5,5-dioxo-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aR,6aS)-5,5-dioxo-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 124577686 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (3aR,6aS)-5,5-dioxo-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | [H]/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1/N=C\c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H19N3O5S2/c1-21-11-4-9(5-12(22-2)14(11)23-3)6-17-18-10-7-25(19,20)8-13(10)24-15(18)16/h4-6,10,13,16H,7-8H2,1-3H3/b16-15-,17-6-/t10-,13-/m1/s1 |
| InChIKey | XYCYBOAJJBDBHG-WFWKOGOXSA-N |
| XLogP | 1.20 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|