C26H21FN4O2S — CID 124577773
[(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3,5-diphenyl-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 124577773) has the molecular formula C26H21FN4O2S and a molecular weight of 472.55 g/mol. Its IUPAC name is [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3,5-diphenyl-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3,5-diphenyl-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 124577773 |
| Molecular Formula | C26H21FN4O2S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3,5-diphenyl-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | [H]/N=C(/S[C@H]1CC(=O)N(c2ccc(F)cc2)C1=O)N1N=C(c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H21FN4O2S/c27-19-11-13-20(14-12-19)30-24(32)16-23(25(30)33)34-26(28)31-22(18-9-5-2-6-10-18)15-21(29-31)17-7-3-1-4-8-17/h1-14,22-23,28H,15-16H2/b28-26+/t22-,23-/m0/s1 |
| InChIKey | YZFSNINMRWTTNF-JMXVQPDPSA-N |
| XLogP | 4.98 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|