C21H20BrN3O5 — CID 124579296
[2-(4-bromo-2-methylanilino)-2-oxoethyl] (3R)-1-benzamido-5-oxopyrrolidine-3-carboxylate (PubChem CID 124579296) has the molecular formula C21H20BrN3O5 and a molecular weight of 474.31 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl] (3R)-1-benzamido-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] (3R)-1-benzamido-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 124579296 |
| Molecular Formula | C21H20BrN3O5 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] (3R)-1-benzamido-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1cc(Br)ccc1NC(=O)COC(=O)[C@@H]1CC(=O)N(NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H20BrN3O5/c1-13-9-16(22)7-8-17(13)23-18(26)12-30-21(29)15-10-19(27)25(11-15)24-20(28)14-5-3-2-4-6-14/h2-9,15H,10-12H2,1H3,(H,23,26)(H,24,28)/t15-/m1/s1 |
| InChIKey | COKXXAHENDWYAE-OAHLLOKOSA-N |
| XLogP | 2.43 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |