C22H17IN4O4 — CID 124581288
2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 124581288) has the molecular formula C22H17IN4O4 and a molecular weight of 528.31 g/mol. Its IUPAC name is 2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 124581288 |
| Molecular Formula | C22H17IN4O4 |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2/C(C)=C(C#N)c3nc(N)c(C#N)c(C)c32)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C22H17IN4O4/c1-10-13(19-11(2)15(8-25)22(26)27-20(19)14(10)7-24)4-12-5-16(23)21(17(6-12)30-3)31-9-18(28)29/h4-6H,9H2,1-3H3,(H2,26,27)(H,28,29)/b13-4- |
| InChIKey | VDEXCKPBCPYTLE-PQMHYQBVSA-N |
| XLogP | 3.77 |
| TPSA | 142.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|