C24H25NO3 — CID 124581490
[(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl] (2R)-2-cyano-2-(3-phenoxyphenyl)acetate (PubChem CID 124581490) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl] (2R)-2-cyano-2-(3-phenoxyphenyl)acetate.
| Compound Name | [(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl] (2R)-2-cyano-2-(3-phenoxyphenyl)acetate |
|---|---|
| PubChem CID | 124581490 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl] (2R)-2-cyano-2-(3-phenoxyphenyl)acetate |
| SMILES | CC(C)=C[C@@H]1[C@H](OC(=O)[C@@H](C#N)c2cccc(Oc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C24H25NO3/c1-16(2)13-21-22(24(21,3)4)28-23(26)20(15-25)17-9-8-12-19(14-17)27-18-10-6-5-7-11-18/h5-14,20-22H,1-4H3/t20-,21+,22-/m0/s1 |
| InChIKey | BJDFGSWVNNJRSS-BDTNDASRSA-N |
| XLogP | 5.62 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|