C12H17N3O5 — CID 124582478
N'-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pyridine-4-carbohydrazide (PubChem CID 124582478) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is N'-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 124582478 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N'-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pyridine-4-carbohydrazide |
| SMILES | C[C@@H]1O[C@H](NNC(=O)c2ccncc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17N3O5/c1-6-8(16)9(17)10(18)12(20-6)15-14-11(19)7-2-4-13-5-3-7/h2-6,8-10,12,15-18H,1H3,(H,14,19)/t6-,8-,9-,10+,12-/m0/s1 |
| InChIKey | PHGDMDPCAKZNGO-CEAFUOJOSA-N |
| XLogP | -1.86 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|