C17H19N3O6 — CID 124583916
(1R,9R,13S)-11-ethyl-1,9-dinitro-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-one (PubChem CID 124583916) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is (1R,9R,13S)-11-ethyl-1,9-dinitro-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-one.
| Compound Name | (1R,9R,13S)-11-ethyl-1,9-dinitro-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 124583916 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (1R,9R,13S)-11-ethyl-1,9-dinitro-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-one |
| SMILES | CCN1C[C@]2([N+](=O)[O-])c3ccccc3C(=O)[C@]([N+](=O)[O-])(C1)[C@H]2CC(C)=O |
| InChI | InChI=1S/C17H19N3O6/c1-3-18-9-16(19(23)24)13-7-5-4-6-12(13)15(22)17(10-18,20(25)26)14(16)8-11(2)21/h4-7,14H,3,8-10H2,1-2H3/t14-,16-,17-/m0/s1 |
| InChIKey | JWYLXXIYJHBGDO-XIRDDKMYSA-N |
| XLogP | 1.30 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|