C25H25NO3 — CID 124584164
(3S)-1-benzyl-3-(4-phenylphenoxy)piperidine-3-carboxylic acid (PubChem CID 124584164) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (3S)-1-benzyl-3-(4-phenylphenoxy)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-benzyl-3-(4-phenylphenoxy)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124584164 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (3S)-1-benzyl-3-(4-phenylphenoxy)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@]1(Oc2ccc(-c3ccccc3)cc2)CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H25NO3/c27-24(28)25(16-7-17-26(19-25)18-20-8-3-1-4-9-20)29-23-14-12-22(13-15-23)21-10-5-2-6-11-21/h1-6,8-15H,7,16-19H2,(H,27,28)/t25-/m0/s1 |
| InChIKey | LIAYWAJSEZVIMU-VWLOTQADSA-N |
| XLogP | 4.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |