C26H29ClIN5O2S — CID 124587092
2-chloro-N-[(1S)-1-[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide (PubChem CID 124587092) has the molecular formula C26H29ClIN5O2S and a molecular weight of 637.98 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-1-[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide.
| Compound Name | 2-chloro-N-[(1S)-1-[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 124587092 |
| Molecular Formula | C26H29ClIN5O2S |
| Molecular Weight | 637.98 g/mol |
| Exact Mass | 637.08 |
| IUPAC Name | 2-chloro-N-[(1S)-1-[5-[2-(4-iodo-2,6-dimethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2c(C)cc(I)cc2C)nnc1[C@@H](NC(=O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C26H29ClIN5O2S/c1-6-11-33-24(22(15(2)3)30-25(35)19-9-7-8-10-20(19)27)31-32-26(33)36-14-21(34)29-23-16(4)12-18(28)13-17(23)5/h6-10,12-13,15,22H,1,11,14H2,2-5H3,(H,29,34)(H,30,35)/t22-/m0/s1 |
| InChIKey | QYBXTXCVFUTXSL-QFIPXVFZSA-N |
| XLogP | 6.20 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.98 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|