C19H24ClN3 — CID 124588776
N-[(1S)-1-(3-chlorophenyl)ethyl]-1-(pyridin-3-ylmethyl)piperidin-4-amine (PubChem CID 124588776) has the molecular formula C19H24ClN3 and a molecular weight of 329.88 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-1-(pyridin-3-ylmethyl)piperidin-4-amine.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-1-(pyridin-3-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 124588776 |
| Molecular Formula | C19H24ClN3 |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-1-(pyridin-3-ylmethyl)piperidin-4-amine |
| SMILES | C[C@H](NC1CCN(Cc2cccnc2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H24ClN3/c1-15(17-5-2-6-18(20)12-17)22-19-7-10-23(11-8-19)14-16-4-3-9-21-13-16/h2-6,9,12-13,15,19,22H,7-8,10-11,14H2,1H3/t15-/m0/s1 |
| InChIKey | FKRRQIJGAKBZKD-HNNXBMFYSA-N |
| XLogP | 4.05 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |