About [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone
[(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone (PubChem CID 124590165) has the molecular formula C17H20FN3O
and a molecular weight of 301.37 g/mol. Its IUPAC name is [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone.
Molecular Properties
| Compound Name | [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone |
| PubChem CID | 124590165 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2c[nH]cc2-c2ccc(F)cc2)C[C@H](C)N1 |
| InChI | InChI=1S/C17H20FN3O/c1-11-9-21(10-12(2)20-11)17(22)16-8-19-7-15(16)13-3-5-14(18)6-4-13/h3-8,11-12,19-20H,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | QHZUKOIVGPTTIV-RYUDHWBXSA-N |
| XLogP | 2.64 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone?
The IUPAC name of [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone (CID 124590165) is [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone.
What is the SMILES notation for [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone?
The canonical SMILES for [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone is C[C@H]1CN(C(=O)c2c[nH]cc2-c2ccc(F)cc2)C[C@H](C)N1.
What is the InChIKey of [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone?
The InChIKey is QHZUKOIVGPTTIV-RYUDHWBXSA-N. The full InChI is InChI=1S/C17H20FN3O/c1-11-9-21(10-12(2)20-11)17(22)16-8-19-7-15(16)13-3-5-14(18)6-4-13/h3-8,11-12,19-20H,9-10H2,1-2H3/t11-,12-/m0/s1.
What are the key properties of [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone?
[(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone has a molecular weight of 301.37 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-3,5-dimethylpiperazin-1-yl]-[4-(4-fluorophenyl)-1H-pyrrol-3-yl]methanone is sourced from PubChem (CID 124590165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).