C17H24N4O2 — CID 124590622
1-[3-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]phenyl]-1,3-diazinan-2-one (PubChem CID 124590622) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[3-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]phenyl]-1,3-diazinan-2-one.
| Compound Name | 1-[3-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 124590622 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[3-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]phenyl]-1,3-diazinan-2-one |
| SMILES | C[C@@H]1CN(C(=O)c2cccc(N3CCCNC3=O)c2)C[C@@H](C)N1 |
| InChI | InChI=1S/C17H24N4O2/c1-12-10-20(11-13(2)19-12)16(22)14-5-3-6-15(9-14)21-8-4-7-18-17(21)23/h3,5-6,9,12-13,19H,4,7-8,10-11H2,1-2H3,(H,18,23)/t12-,13-/m1/s1 |
| InChIKey | ZXRNUSXZGIEYJB-CHWSQXEVSA-N |
| XLogP | 1.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |