C18H31N3O — CID 124591057
(1-tert-butylpyrazol-4-yl)-[(2S)-2-(2-methylpropyl)azepan-1-yl]methanone (PubChem CID 124591057) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (1-tert-butylpyrazol-4-yl)-[(2S)-2-(2-methylpropyl)azepan-1-yl]methanone.
| Compound Name | (1-tert-butylpyrazol-4-yl)-[(2S)-2-(2-methylpropyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 124591057 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (1-tert-butylpyrazol-4-yl)-[(2S)-2-(2-methylpropyl)azepan-1-yl]methanone |
| SMILES | CC(C)C[C@@H]1CCCCCN1C(=O)c1cnn(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H31N3O/c1-14(2)11-16-9-7-6-8-10-20(16)17(22)15-12-19-21(13-15)18(3,4)5/h12-14,16H,6-11H2,1-5H3/t16-/m0/s1 |
| InChIKey | SJYOXSNWHANXAV-INIZCTEOSA-N |
| XLogP | 4.07 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |