C13H19F3N4O — CID 124591095
[(3R)-3-methylpiperazin-1-yl]-[1-propan-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone (PubChem CID 124591095) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is [(3R)-3-methylpiperazin-1-yl]-[1-propan-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone.
| Compound Name | [(3R)-3-methylpiperazin-1-yl]-[1-propan-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 124591095 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(3R)-3-methylpiperazin-1-yl]-[1-propan-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone |
| SMILES | CC(C)n1ncc(C(=O)N2CCN[C@H](C)C2)c1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N4O/c1-8(2)20-11(13(14,15)16)10(6-18-20)12(21)19-5-4-17-9(3)7-19/h6,8-9,17H,4-5,7H2,1-3H3/t9-/m1/s1 |
| InChIKey | NDPAKRAIOSQOAE-SECBINFHSA-N |
| XLogP | 1.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |