About [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea
[(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea (PubChem CID 124591359) has the molecular formula C8H13F3N2O
and a molecular weight of 210.20 g/mol. Its IUPAC name is [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea.
Molecular Properties
| Compound Name | [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea |
| PubChem CID | 124591359 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea |
| SMILES | NC(=O)N[C@@H](C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O/c9-8(10,11)6(13-7(12)14)5-3-1-2-4-5/h5-6H,1-4H2,(H3,12,13,14)/t6-/m0/s1 |
| InChIKey | JCFLMLGIZMVOTF-LURJTMIESA-N |
| XLogP | 1.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea?
The IUPAC name of [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea (CID 124591359) is [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea.
What is the SMILES notation for [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea?
The canonical SMILES for [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea is NC(=O)N[C@@H](C1CCCC1)C(F)(F)F.
What is the InChIKey of [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea?
The InChIKey is JCFLMLGIZMVOTF-LURJTMIESA-N. The full InChI is InChI=1S/C8H13F3N2O/c9-8(10,11)6(13-7(12)14)5-3-1-2-4-5/h5-6H,1-4H2,(H3,12,13,14)/t6-/m0/s1.
What are the key properties of [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea?
[(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea has a molecular weight of 210.20 g/mol, XLogP of 1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]urea is sourced from PubChem (CID 124591359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).