C20H19N3O3 — CID 124591822
N-cyclopropyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-5-(3-methylphenyl)pyridine-3-carboxamide (PubChem CID 124591822) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-5-(3-methylphenyl)pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-5-(3-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124591822 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-cyclopropyl-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-5-(3-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(-c2cncc(C(=O)N(C3CC3)[C@H]3CC(=O)NC3=O)c2)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-12-3-2-4-13(7-12)14-8-15(11-21-10-14)20(26)23(16-5-6-16)17-9-18(24)22-19(17)25/h2-4,7-8,10-11,16-17H,5-6,9H2,1H3,(H,22,24,25)/t17-/m0/s1 |
| InChIKey | XUEPGLYTQBZNEP-KRWDZBQOSA-N |
| XLogP | 2.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|