About N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide
N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide (PubChem CID 124593195) has the molecular formula C16H15N5OS
and a molecular weight of 325.40 g/mol. Its IUPAC name is N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide |
| PubChem CID | 124593195 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide |
| SMILES | C[C@@H]1C[C@@H]1c1cc(NC(=O)c2cnns2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H15N5OS/c1-10-7-12(10)13-8-15(18-16(22)14-9-17-20-23-14)21(19-13)11-5-3-2-4-6-11/h2-6,8-10,12H,7H2,1H3,(H,18,22)/t10-,12+/m1/s1 |
| InChIKey | YVTNCFFMHYGYFP-PWSUYJOCSA-N |
| XLogP | 3.10 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide?
The IUPAC name of N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide (CID 124593195) is N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide.
What is the SMILES notation for N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide?
The canonical SMILES for N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide is C[C@@H]1C[C@@H]1c1cc(NC(=O)c2cnns2)n(-c2ccccc2)n1.
What is the InChIKey of N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide?
The InChIKey is YVTNCFFMHYGYFP-PWSUYJOCSA-N. The full InChI is InChI=1S/C16H15N5OS/c1-10-7-12(10)13-8-15(18-16(22)14-9-17-20-23-14)21(19-13)11-5-3-2-4-6-11/h2-6,8-10,12H,7H2,1H3,(H,18,22)/t10-,12+/m1/s1.
What are the key properties of N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide?
N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide has a molecular weight of 325.40 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(1S,2R)-2-methylcyclopropyl]-1-phenylpyrazol-5-yl]thiadiazole-5-carboxamide is sourced from PubChem (CID 124593195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).