C15H24N2O3 — CID 124593338
methyl (3R)-1-[[(1R)-cyclohex-3-en-1-yl]methylcarbamoyl]piperidine-3-carboxylate (PubChem CID 124593338) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl (3R)-1-[[(1R)-cyclohex-3-en-1-yl]methylcarbamoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3R)-1-[[(1R)-cyclohex-3-en-1-yl]methylcarbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 124593338 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | methyl (3R)-1-[[(1R)-cyclohex-3-en-1-yl]methylcarbamoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN(C(=O)NC[C@H]2CC=CCC2)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-20-14(18)13-8-5-9-17(11-13)15(19)16-10-12-6-3-2-4-7-12/h2-3,12-13H,4-11H2,1H3,(H,16,19)/t12-,13+/m0/s1 |
| InChIKey | MMQPLULLCAURAK-QWHCGFSZSA-N |
| XLogP | 1.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|