About (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide
(3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide (PubChem CID 124593890) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide |
| PubChem CID | 124593890 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)N3CC[C@@H](c4ccccc4)C3)ccc2o1 |
| InChI | InChI=1S/C19H19N3O2/c1-13-20-17-11-16(7-8-18(17)24-13)21-19(23)22-10-9-15(12-22)14-5-3-2-4-6-14/h2-8,11,15H,9-10,12H2,1H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | LKRBRNVSBPCSRM-OAHLLOKOSA-N |
| XLogP | 4.16 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide?
The IUPAC name of (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide (CID 124593890) is (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide.
What is the SMILES notation for (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide?
The canonical SMILES for (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide is Cc1nc2cc(NC(=O)N3CC[C@@H](c4ccccc4)C3)ccc2o1.
What is the InChIKey of (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide?
The InChIKey is LKRBRNVSBPCSRM-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H19N3O2/c1-13-20-17-11-16(7-8-18(17)24-13)21-19(23)22-10-9-15(12-22)14-5-3-2-4-6-14/h2-8,11,15H,9-10,12H2,1H3,(H,21,23)/t15-/m1/s1.
What are the key properties of (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide?
(3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide has a molecular weight of 321.38 g/mol, XLogP of 4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-(2-methyl-1,3-benzoxazol-5-yl)-3-phenylpyrrolidine-1-carboxamide is sourced from PubChem (CID 124593890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).