C15H21BrN2O3S — CID 124594197
(2R)-1-[(3S)-3-aminopiperidin-1-yl]-3-(4-bromophenyl)sulfonyl-2-methylpropan-1-one (PubChem CID 124594197) has the molecular formula C15H21BrN2O3S and a molecular weight of 389.32 g/mol. Its IUPAC name is (2R)-1-[(3S)-3-aminopiperidin-1-yl]-3-(4-bromophenyl)sulfonyl-2-methylpropan-1-one.
| Compound Name | (2R)-1-[(3S)-3-aminopiperidin-1-yl]-3-(4-bromophenyl)sulfonyl-2-methylpropan-1-one |
|---|---|
| PubChem CID | 124594197 |
| Molecular Formula | C15H21BrN2O3S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (2R)-1-[(3S)-3-aminopiperidin-1-yl]-3-(4-bromophenyl)sulfonyl-2-methylpropan-1-one |
| SMILES | C[C@@H](CS(=O)(=O)c1ccc(Br)cc1)C(=O)N1CCC[C@H](N)C1 |
| InChI | InChI=1S/C15H21BrN2O3S/c1-11(15(19)18-8-2-3-13(17)9-18)10-22(20,21)14-6-4-12(16)5-7-14/h4-7,11,13H,2-3,8-10,17H2,1H3/t11-,13-/m0/s1 |
| InChIKey | JJTJPQGWAHQSKU-AAEUAGOBSA-N |
| XLogP | 1.81 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |