About cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine
cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine (PubChem CID 124594484) has the molecular formula C6H11F2NO
and a molecular weight of 151.16 g/mol. Its IUPAC name is cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine |
| PubChem CID | 124594484 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine |
| SMILES | N[C@H]1CCC[C@H]1OC(F)F |
| InChI | InChI=1S/C6H11F2NO/c7-6(8)10-5-3-1-2-4(5)9/h4-6H,1-3,9H2/t4-,5+/m0/s1 |
| InChIKey | HDAQBVUGOMOFIG-CRCLSJGQSA-N |
| XLogP | 1.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine?
The IUPAC name of cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine (CID 124594484) is cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine.
What is the SMILES notation for cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine?
The canonical SMILES for cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine is N[C@H]1CCC[C@H]1OC(F)F.
What is the InChIKey of cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine?
The InChIKey is HDAQBVUGOMOFIG-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H11F2NO/c7-6(8)10-5-3-1-2-4(5)9/h4-6H,1-3,9H2/t4-,5+/m0/s1.
What are the key properties of cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine?
cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine has a molecular weight of 151.16 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-(difluoromethoxy)cyclopentan-1-amine is sourced from PubChem (CID 124594484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).