C9H13F3N2O3 — CID 124596167
(2R)-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]pent-4-enoic acid (PubChem CID 124596167) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is (2R)-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]pent-4-enoic acid.
| Compound Name | (2R)-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 124596167 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2R)-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]pent-4-enoic acid |
| SMILES | C=CC[C@@H](NC(=O)CNCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H13F3N2O3/c1-2-3-6(8(16)17)14-7(15)4-13-5-9(10,11)12/h2,6,13H,1,3-5H2,(H,14,15)(H,16,17)/t6-/m1/s1 |
| InChIKey | KNJVKEJYLQBVLK-ZCFIWIBFSA-N |
| XLogP | 0.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|