C27H22Br2N4O2S — CID 124596956
[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 124596956) has the molecular formula C27H22Br2N4O2S and a molecular weight of 626.37 g/mol. Its IUPAC name is [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 124596956 |
| Molecular Formula | C27H22Br2N4O2S |
| Molecular Weight | 626.37 g/mol |
| Exact Mass | 623.98 |
| IUPAC Name | [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | [H]/N=C(/S[C@H]1CC(=O)N(c2ccc(Br)cc2)C1=O)N1N=C(c2ccc(C)cc2)C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H22Br2N4O2S/c1-16-2-4-17(5-3-16)22-14-23(18-6-8-19(28)9-7-18)33(31-22)27(30)36-24-15-25(34)32(26(24)35)21-12-10-20(29)11-13-21/h2-13,23-24,30H,14-15H2,1H3/b30-27+/t23-,24-/m0/s1 |
| InChIKey | VFMYDIRUNSWELC-DZJYICHGSA-N |
| XLogP | 6.67 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.37 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|