C15H16N2O5S — CID 124597022
3-hydroxy-N-[(2S,4R)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]-4-nitrobenzamide (PubChem CID 124597022) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is 3-hydroxy-N-[(2S,4R)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]-4-nitrobenzamide.
| Compound Name | 3-hydroxy-N-[(2S,4R)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 124597022 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-hydroxy-N-[(2S,4R)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]-4-nitrobenzamide |
| SMILES | C[C@@H](C[C@@H](O)c1cccs1)NC(=O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C15H16N2O5S/c1-9(7-13(19)14-3-2-6-23-14)16-15(20)10-4-5-11(17(21)22)12(18)8-10/h2-6,8-9,13,18-19H,7H2,1H3,(H,16,20)/t9-,13+/m0/s1 |
| InChIKey | YHTDEVPYVZYELN-TVQRCGJNSA-N |
| XLogP | 2.60 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|