About 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide
2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide (PubChem CID 124598335) has the molecular formula C16H23NO2S
and a molecular weight of 293.43 g/mol. Its IUPAC name is 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide |
| PubChem CID | 124598335 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)CS[C@@H]1CCO[C@@H]1C)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2S/c1-12(2)17(14-7-5-4-6-8-14)16(18)11-20-15-9-10-19-13(15)3/h4-8,12-13,15H,9-11H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | OJDONGOKTJPMKL-UKRRQHHQSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide?
The IUPAC name of 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide (CID 124598335) is 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide?
The canonical SMILES for 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide is CC(C)N(C(=O)CS[C@@H]1CCO[C@@H]1C)c1ccccc1.
What is the InChIKey of 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide?
The InChIKey is OJDONGOKTJPMKL-UKRRQHHQSA-N. The full InChI is InChI=1S/C16H23NO2S/c1-12(2)17(14-7-5-4-6-8-14)16(18)11-20-15-9-10-19-13(15)3/h4-8,12-13,15H,9-11H2,1-3H3/t13-,15-/m1/s1.
What are the key properties of 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide?
2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide has a molecular weight of 293.43 g/mol, XLogP of 3.34, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3R)-2-methyloxolan-3-yl]sulfanyl-N-phenyl-N-propan-2-ylacetamide is sourced from PubChem (CID 124598335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).