C23H16Br3N3O3 — CID 124601004
(5E)-5-[[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(4-bromophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 124601004) has the molecular formula C23H16Br3N3O3 and a molecular weight of 622.11 g/mol. Its IUPAC name is (5E)-5-[[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(4-bromophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(4-bromophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124601004 |
| Molecular Formula | C23H16Br3N3O3 |
| Molecular Weight | 622.11 g/mol |
| Exact Mass | 618.87 |
| IUPAC Name | (5E)-5-[[4-bromo-1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(4-bromophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(Br)c(/C=C2\C(=O)NC(=O)N(c3ccc(Br)cc3)C2=O)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H16Br3N3O3/c1-12-18(20(26)13(2)28(12)16-7-3-14(24)4-8-16)11-19-21(30)27-23(32)29(22(19)31)17-9-5-15(25)6-10-17/h3-11H,1-2H3,(H,27,30,32)/b19-11+ |
| InChIKey | UQFKFGCPROWQJA-YBFXNURJSA-N |
| XLogP | 6.05 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.11 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|