C24H13Br2Cl2FN2O3S — CID 124601346
(5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124601346) has the molecular formula C24H13Br2Cl2FN2O3S and a molecular weight of 659.16 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124601346 |
| Molecular Formula | C24H13Br2Cl2FN2O3S |
| Molecular Weight | 659.16 g/mol |
| Exact Mass | 655.84 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccccc2F)C(=O)/C1=C/c1cc(Br)c(OCc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C24H13Br2Cl2FN2O3S/c25-16-8-12(9-17(26)21(16)34-11-13-5-6-14(27)10-18(13)28)7-15-22(32)30-24(35)31(23(15)33)20-4-2-1-3-19(20)29/h1-10H,11H2,(H,30,32,35)/b15-7+ |
| InChIKey | MYFACKUYJVAAJM-VIZOYTHASA-N |
| XLogP | 7.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.16 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|