C20H15BrIN3O5S — CID 124601488
5-[[3-bromo-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124601488) has the molecular formula C20H15BrIN3O5S and a molecular weight of 616.23 g/mol. Its IUPAC name is 5-[[3-bromo-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3-bromo-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124601488 |
| Molecular Formula | C20H15BrIN3O5S |
| Molecular Weight | 616.23 g/mol |
| Exact Mass | 614.90 |
| IUPAC Name | 5-[[3-bromo-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(=Cc2cc(Br)c(OCc3ccc([N+](=O)[O-])cc3)c(I)c2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C20H15BrIN3O5S/c1-23-18(26)14(19(27)24(2)20(23)31)7-12-8-15(21)17(16(22)9-12)30-10-11-3-5-13(6-4-11)25(28)29/h3-9H,10H2,1-2H3 |
| InChIKey | OELGNOQESKIOSR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|