C32H19F3N6O4S — CID 124602675
(2R)-3-(2,4-dinitrophenyl)-4'-naphthalen-1-yl-2'-phenyl-5-(trifluoromethyl)spiro[1,3,4-thiadiazole-2,1'-phthalazine] (PubChem CID 124602675) has the molecular formula C32H19F3N6O4S and a molecular weight of 640.60 g/mol. Its IUPAC name is (2R)-3-(2,4-dinitrophenyl)-4'-naphthalen-1-yl-2'-phenyl-5-(trifluoromethyl)spiro[1,3,4-thiadiazole-2,1'-phthalazine].
| Compound Name | (2R)-3-(2,4-dinitrophenyl)-4'-naphthalen-1-yl-2'-phenyl-5-(trifluoromethyl)spiro[1,3,4-thiadiazole-2,1'-phthalazine] |
|---|---|
| PubChem CID | 124602675 |
| Molecular Formula | C32H19F3N6O4S |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | (2R)-3-(2,4-dinitrophenyl)-4'-naphthalen-1-yl-2'-phenyl-5-(trifluoromethyl)spiro[1,3,4-thiadiazole-2,1'-phthalazine] |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(C(F)(F)F)S[C@@]23c2ccccc2C(c2cccc4ccccc24)=NN3c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H19F3N6O4S/c33-31(34,35)30-37-39(27-18-17-22(40(42)43)19-28(27)41(44)45)32(46-30)26-16-7-6-14-25(26)29(36-38(32)21-11-2-1-3-12-21)24-15-8-10-20-9-4-5-13-23(20)24/h1-19H/t32-/m1/s1 |
| InChIKey | YPCSXULFMICNDR-JGCGQSQUSA-N |
| XLogP | 8.17 |
| TPSA | 117.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|