(2R)-2-methoxy-2-(4-phenylphenyl)acetic acid

C15H14O3 — CID 124603467

IUPAC(2R)-2-methoxy-2-(4-phenylphenyl)acetic acid
SMILESCO[C@@H](C(=O)O)c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C15H14O3/c1-18-14(15(16)17)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10,14H,1H3,(H,16,17)/t14-/m1/s1
InChIKeyLCQRFOLVBUJLKY-CQSZACIVSA-N
MW242.27 g/mol
LogP3.13
Rot. Bonds4

About (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid

(2R)-2-methoxy-2-(4-phenylphenyl)acetic acid (PubChem CID 124603467) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid.

Molecular Properties

Compound Name(2R)-2-methoxy-2-(4-phenylphenyl)acetic acid
PubChem CID124603467
Molecular FormulaC15H14O3
Molecular Weight242.27 g/mol
Exact Mass242.09
IUPAC Name(2R)-2-methoxy-2-(4-phenylphenyl)acetic acid
SMILESCO[C@@H](C(=O)O)c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C15H14O3/c1-18-14(15(16)17)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10,14H,1H3,(H,16,17)/t14-/m1/s1
InChIKeyLCQRFOLVBUJLKY-CQSZACIVSA-N
XLogP3.13
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.27
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[4-(4-chlorophenyl)phenyl]-2-methoxyacetic acid
CID 70572133
(2S)-2-methoxy-2-(4-phenoxyphenyl)acetic acid
CID 129384207
2-[4-(difluoromethyl)phenyl]-2-methoxyacetic acid
CID 116769538
2-methoxy-2-(4-methoxycarbonylphenyl)acetic acid
CID 21261883
(2S)-2-methoxy-2-[4-(trifluoromethyl)phenyl]acetic acid
CID 97052451
CID 59883683
CID 59883683
2-(4-ethoxyphenyl)-2-methoxyacetic acid
CID 83224411
2-(3-hydroxypropoxy)-2-(4-phenylphenyl)acetic acid
CID 103378054
2-methoxy-2-[3-[4-(trifluoromethoxy)phenyl]phenyl]acetic acid
CID 122534355
(2R)-2-methoxy-2-phenylethanethioic S-acid
CID 10910184
2-methoxy-2-phenylacetate
CID 4569340
2-(3,4-dimethylphenyl)-2-methoxyacetic acid
CID 83224323

Frequently Asked Questions

What is the IUPAC name of (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid?
The IUPAC name of (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid (CID 124603467) is (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid.
What is the SMILES notation for (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid?
The canonical SMILES for (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid is CO[C@@H](C(=O)O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid?
The InChIKey is LCQRFOLVBUJLKY-CQSZACIVSA-N. The full InChI is InChI=1S/C15H14O3/c1-18-14(15(16)17)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10,14H,1H3,(H,16,17)/t14-/m1/s1.
What are the key properties of (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid?
(2R)-2-methoxy-2-(4-phenylphenyl)acetic acid has a molecular weight of 242.27 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methoxy-2-(4-phenylphenyl)acetic acid is sourced from PubChem (CID 124603467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).