C21H19FN2O4S — CID 124605419
N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzenesulfonamide (PubChem CID 124605419) has the molecular formula C21H19FN2O4S and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzenesulfonamide.
| Compound Name | N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 124605419 |
| Molecular Formula | C21H19FN2O4S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzenesulfonamide |
| SMILES | COc1cc(/C=N\NS(=O)(=O)c2ccccc2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C21H19FN2O4S/c1-27-21-13-16(14-23-24-29(25,26)18-8-3-2-4-9-18)11-12-20(21)28-15-17-7-5-6-10-19(17)22/h2-14,24H,15H2,1H3/b23-14- |
| InChIKey | YUENGFPDFPZESO-UCQKPKSFSA-N |
| XLogP | 3.73 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|