C15H23NO2S2 — CID 124606298
N-methyl-2-[[(2R)-oxan-2-yl]methylsulfanyl]-N-[(1S)-1-thiophen-2-ylethyl]acetamide (PubChem CID 124606298) has the molecular formula C15H23NO2S2 and a molecular weight of 313.49 g/mol. Its IUPAC name is N-methyl-2-[[(2R)-oxan-2-yl]methylsulfanyl]-N-[(1S)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | N-methyl-2-[[(2R)-oxan-2-yl]methylsulfanyl]-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 124606298 |
| Molecular Formula | C15H23NO2S2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-methyl-2-[[(2R)-oxan-2-yl]methylsulfanyl]-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
| SMILES | C[C@@H](c1cccs1)N(C)C(=O)CSC[C@H]1CCCCO1 |
| InChI | InChI=1S/C15H23NO2S2/c1-12(14-7-5-9-20-14)16(2)15(17)11-19-10-13-6-3-4-8-18-13/h5,7,9,12-13H,3-4,6,8,10-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | JWBCVMWQWOFFBU-QWHCGFSZSA-N |
| XLogP | 3.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |