About [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone
[(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone (PubChem CID 124607700) has the molecular formula C16H16N2O4S
and a molecular weight of 332.38 g/mol. Its IUPAC name is [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone.
Molecular Properties
| Compound Name | [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone |
| PubChem CID | 124607700 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone |
| SMILES | C[C@H]1CN(C(=O)c2ccc([N+](=O)[O-])s2)[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C16H16N2O4S/c1-11-9-17(13(10-22-11)12-5-3-2-4-6-12)16(19)14-7-8-15(23-14)18(20)21/h2-8,11,13H,9-10H2,1H3/t11-,13+/m0/s1 |
| InChIKey | OABLHNWMTKQFJI-WCQYABFASA-N |
| XLogP | 3.26 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone?
The IUPAC name of [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone (CID 124607700) is [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone.
What is the SMILES notation for [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone?
The canonical SMILES for [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone is C[C@H]1CN(C(=O)c2ccc([N+](=O)[O-])s2)[C@@H](c2ccccc2)CO1.
What is the InChIKey of [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone?
The InChIKey is OABLHNWMTKQFJI-WCQYABFASA-N. The full InChI is InChI=1S/C16H16N2O4S/c1-11-9-17(13(10-22-11)12-5-3-2-4-6-12)16(19)14-7-8-15(23-14)18(20)21/h2-8,11,13H,9-10H2,1H3/t11-,13+/m0/s1.
What are the key properties of [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone?
[(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone has a molecular weight of 332.38 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5S)-2-methyl-5-phenylmorpholin-4-yl]-(5-nitrothiophen-2-yl)methanone is sourced from PubChem (CID 124607700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).